CAS 1260637-82-8

6-Chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid

Description:

6-Chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline framework. This compound features a chloro substituent at the 6-position and a 4-fluorophenyl group at the 2-position, contributing to its unique chemical properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The compound's molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and reactivity can be influenced by the electron-withdrawing effects of the chloro and fluoro substituents, which may affect its pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogenated groups, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₃ClFNO₂

InChI: InChI=1S/C16H13ClFNO2/c17-11-1-6-14-10(9-11)7-8-19(15(14)16(20)21)13-4-2-12(18)3-5-13/h1-6,9,15H,7-8H2,(H,20,21)

InChI key: InChIKey=RGWVNXMJJOUGRD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(CCN1C3=CC=C(F)C=C3)=CC(Cl)=CC2

Synonyms:

• 1-Isoquinolinecarboxylic acid, 6-chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydro-
• 6-Chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid

6-Chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

CAS: 1260637-82-8

6-Chloro-2-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

Molecular weight: 305.73132g/mol

Ref: 54-PC107797