
CAS 1260637-95-3
:3-Fluoro-2-(3-pyrrolidinyl)pyridine
Description:
3-Fluoro-2-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a pyrrolidine group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents due to the polar nature of the pyridine and pyrrolidine moieties. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks are often investigated for their biological activity. The fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable candidate in drug design. Additionally, the presence of the pyrrolidine ring may influence the compound's interaction with biological targets, potentially affecting its pharmacokinetic and pharmacodynamic profiles. As with many nitrogen-containing heterocycles, it may also exhibit basic properties, allowing it to participate in various chemical reactions.
Formula:C9H11FN2
InChI:InChI=1S/C9H11FN2/c10-8-2-1-4-12-9(8)7-3-5-11-6-7/h1-2,4,7,11H,3,5-6H2
InChI key:InChIKey=DIPHQLDVFQZAMS-UHFFFAOYSA-N
SMILES:FC1=C(C2CCNC2)N=CC=C1
Synonyms:- 3-Fluoro-2-(3-pyrrolidinyl)pyridine
- Pyridine, 3-fluoro-2-(3-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.