CAS 1260638-90-1

1-Isoquinolinecarboxylic acid, 6-chloro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

1-Isoquinolinecarboxylic acid, 6-chloro-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The "6-chloro" designation suggests that a chlorine atom is substituted at the sixth position of the isoquinoline ring, which can influence the compound's reactivity and biological activity. The "1,2,3,4-tetrahydro" descriptor indicates that the compound has a partially saturated ring system, which may affect its physical properties, such as solubility and stability. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry, though specific biological properties would require further investigation.

Formula: C₁₀H₁₀ClNO₂·ClH

InChI: InChI=1S/C10H10ClNO2.ClH/c11-7-1-2-8-6(5-7)3-4-12-9(8)10(13)14;/h1-2,5,9,12H,3-4H2,(H,13,14);1H

InChI key: InChIKey=ARPMFACXGFEBFK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(=CC(Cl)=CC2)CCN1.Cl

Synonyms:

• 1-Isoquinolinecarboxylic acid, 6-chloro-1,2,3,4-tetrahydro-, hydrochloride (1:1)