CAS 1260640-70-7
:N-[(1,1-Dimethylethoxy)carbonyl]-4-oxonorvaline methyl ester
Description:
N-[(1,1-Dimethylethoxy)carbonyl]-4-oxonorvaline methyl ester is a chemical compound characterized by its unique structure, which includes a carbonyl group and an ester functional group. This compound is a derivative of norvaline, an amino acid, and features a dimethylethoxy carbonyl substituent that enhances its stability and solubility. The presence of the oxo group contributes to its reactivity, making it suitable for various synthetic applications in organic chemistry. Typically, compounds like this are utilized in peptide synthesis and as intermediates in the production of pharmaceuticals. Its molecular structure suggests potential for specific interactions in biological systems, which may be explored in medicinal chemistry. The compound is likely to be a white to off-white solid, and its properties, such as melting point and solubility, would depend on the specific conditions and purity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C11H19NO5
InChI:InChI=1S/C11H19NO5/c1-7(13)6-8(9(14)16-5)12-10(15)17-11(2,3)4/h8H,6H2,1-5H3,(H,12,15)
InChI key:InChIKey=BITKFESLEDFJMG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(NC(OC(C)(C)C)=O)CC(C)=O
Synonyms:- N-[(1,1-Dimethylethoxy)carbonyl]-4-oxonorvaline methyl ester
- Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
methyl 2-{[(tert-butoxy)carbonyl]amino}-4-oxopentanoate
CAS:Formula:C11H19NO5Molecular weight:245.2723
