CymitQuimica logo

CAS 1260642-77-0

:

2-(3-Azetidinyl)-5-(phenylmethoxy)phenol

Description:
2-(3-Azetidinyl)-5-(phenylmethoxy)phenol is a chemical compound characterized by its unique structural features, which include a phenolic group, an azetidine ring, and a phenylmethoxy substituent. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as azetidines are often found in biologically active compounds. The phenolic component contributes to the compound's potential antioxidant properties, while the phenylmethoxy group may enhance lipophilicity, influencing its bioavailability and interaction with biological targets. This compound's molecular structure indicates it may exhibit interesting pharmacological activities, although specific biological data would be necessary to confirm its efficacy and safety. Additionally, the compound's synthesis and stability under various conditions would be important for practical applications. As with many organic compounds, understanding its reactivity, solubility, and interaction with other substances is crucial for its potential use in various fields, including pharmaceuticals and materials science.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c18-16-8-14(6-7-15(16)13-9-17-10-13)19-11-12-4-2-1-3-5-12/h1-8,13,17-18H,9-11H2
InChI key:InChIKey=ARMZLYMCQABVMC-UHFFFAOYSA-N
SMILES:OC1=C(C2CNC2)C=CC(OCC3=CC=CC=C3)=C1
Synonyms:
  • Phenol, 2-(3-azetidinyl)-5-(phenylmethoxy)-
  • 2-(3-Azetidinyl)-5-(phenylmethoxy)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.