CAS 1260642-83-8
:α-[[(Phenylmethoxy)carbonyl]amino]-3-oxetaneacetic acid
Description:
α-[[(Phenylmethoxy)carbonyl]amino]-3-oxetaneacetic acid, with CAS number 1260642-83-8, is a synthetic organic compound characterized by its unique structural features, including an oxetane ring and an amino acid backbone. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. The presence of the phenylmethoxycarbonyl group suggests that it may have applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Its oxetane structure can impart strain, potentially leading to interesting reactivity patterns. Additionally, the compound may exhibit biological activity, making it a candidate for further investigation in medicinal chemistry. Overall, the combination of functional groups and the cyclic structure contributes to its potential utility in various chemical applications, although specific characteristics such as melting point, boiling point, and spectral data would require empirical determination for precise characterization.
Formula:C13H15NO5
InChI:InChI=1S/C13H15NO5/c15-12(16)11(10-7-18-8-10)14-13(17)19-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,14,17)(H,15,16)
InChI key:InChIKey=OAUKFGIMQKMVHE-UHFFFAOYSA-N
SMILES:C(NC(OCC1=CC=CC=C1)=O)(C(O)=O)C2COC2
Synonyms:- 3-Oxetaneacetic acid, α-[[(phenylmethoxy)carbonyl]amino]-
- α-[[(Phenylmethoxy)carbonyl]amino]-3-oxetaneacetic acid
- 2-[[(Benzyloxy)carbonyl]amino]-2-(oxetan-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.