
CAS 1260642-93-0
:1H-Benzimidazole, 6-(trifluoromethyl)-, hydrochloride (1:1)
Description:
1H-Benzimidazole, 6-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a trifluoromethyl group at the 6-position enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and the trifluoromethyl group can also affect the compound's electronic properties and reactivity. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, 1H-Benzimidazole, 6-(trifluoromethyl)-, hydrochloride is a notable compound in the realm of organic and medicinal chemistry.
Formula:C8H5F3N2·ClH
InChI:InChI=1S/C8H5F3N2.ClH/c9-8(10,11)5-1-2-6-7(3-5)13-4-12-6;/h1-4H,(H,12,13);1H
InChI key:InChIKey=UTXTYBVGNRTFLR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(=CC1)N=CN2.Cl
Synonyms:- 1H-Benzimidazole, 6-(trifluoromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.