
CAS 1260644-18-5
:2-(3-Azetidinyl)-5-methylphenol
Description:
2-(3-Azetidinyl)-5-methylphenol is a chemical compound characterized by its unique structure, which includes a phenolic group and an azetidine ring. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The methyl group at the 5-position of the phenol ring can influence the compound's lipophilicity and overall biological activity. This compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, which may affect its interactions in biological systems. As with many compounds, the specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or detailed computational analysis for precise determination. Overall, 2-(3-Azetidinyl)-5-methylphenol represents a compound of interest in the field of organic chemistry and pharmacology.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-7-2-3-9(10(12)4-7)8-5-11-6-8/h2-4,8,11-12H,5-6H2,1H3
InChI key:InChIKey=BKPUCCMFZUZBMB-UHFFFAOYSA-N
SMILES:OC1=C(C2CNC2)C=CC(C)=C1
Synonyms:- Phenol, 2-(3-azetidinyl)-5-methyl-
- 2-(3-Azetidinyl)-5-methylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.