CymitQuimica logo

CAS 1260645-96-2

:

3-(3-Azetidinyl)-5-methylpyridine

Description:
3-(3-Azetidinyl)-5-methylpyridine, identified by its CAS number 1260645-96-2, is a chemical compound that features a pyridine ring substituted with a methyl group and an azetidine moiety. The presence of the azetidine ring introduces unique steric and electronic properties, which can influence the compound's reactivity and potential biological activity. Pyridine derivatives are known for their diverse applications in pharmaceuticals, agrochemicals, and as ligands in coordination chemistry. The methyl group at the 5-position of the pyridine ring can affect the compound's lipophilicity and solubility, which are critical factors in drug design. Additionally, the azetidine ring may contribute to the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Overall, the structural characteristics of 3-(3-Azetidinyl)-5-methylpyridine suggest potential utility in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise values.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-7-2-8(4-10-3-7)9-5-11-6-9/h2-4,9,11H,5-6H2,1H3
InChI key:InChIKey=VJMIRXYEZJZBBG-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1)C2CNC2
Synonyms:
  • 3-(3-Azetidinyl)-5-methylpyridine
  • Pyridine, 3-(3-azetidinyl)-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.