CymitQuimica logo

CAS 1260646-04-5

:

2-Chloro-6-(4-piperidinyl)phenol

Description:
2-Chloro-6-(4-piperidinyl)phenol is an organic compound characterized by its phenolic structure, which includes a chlorine substituent at the second position and a piperidine ring at the sixth position of the phenol. This compound typically appears as a solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic and aliphatic components. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often associated with pharmacological properties. The chlorine atom introduces additional reactivity and can influence the compound's interaction with biological targets. In terms of safety, like many chlorinated compounds, it may pose risks such as toxicity or environmental concerns, necessitating careful handling and disposal. Its applications may span various fields, including medicinal chemistry and materials science, where it could serve as an intermediate or active ingredient in drug development. Overall, 2-Chloro-6-(4-piperidinyl)phenol is a compound of interest due to its structural features and potential utility in various chemical and biological contexts.
Formula:C11H14ClNO
InChI:InChI=1S/C11H14ClNO/c12-10-3-1-2-9(11(10)14)8-4-6-13-7-5-8/h1-3,8,13-14H,4-7H2
InChI key:InChIKey=GFLYGLNSDPCABW-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1Cl)C2CCNCC2
Synonyms:
  • Phenol, 2-chloro-6-(4-piperidinyl)-
  • 2-Chloro-6-(4-piperidinyl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.