CymitQuimica logo

CAS 1260649-12-4

:

2-Bromo-6-(3-piperidinyl)phenol

Description:
2-Bromo-6-(3-piperidinyl)phenol is an organic compound characterized by its phenolic structure, which includes a bromine atom and a piperidine substituent. The presence of the bromine atom at the 2-position of the phenol ring enhances its reactivity, making it useful in various chemical syntheses. The piperidine group, located at the 6-position, contributes to the compound's potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions of use. Additionally, safety considerations should be taken into account, as brominated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 2-Bromo-6-(3-piperidinyl)phenol is of interest in medicinal chemistry and material science due to its unique structural features.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c12-10-5-1-4-9(11(10)14)8-3-2-6-13-7-8/h1,4-5,8,13-14H,2-3,6-7H2
InChI key:InChIKey=LTVAKPRYFJCGGG-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1Br)C2CCCNC2
Synonyms:
  • 2-Bromo-6-(3-piperidinyl)phenol
  • Phenol, 2-bromo-6-(3-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.