CymitQuimica logo

CAS 1260650-70-1

:

3-(2,5-Dimethyl-3-thienyl)pyrrolidine

Description:
3-(2,5-Dimethyl-3-thienyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. The presence of two methyl groups on the thienyl ring enhances its steric and electronic characteristics, which can influence the compound's solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the pyrrolidine ring is known for its role in various biological activities and can serve as a scaffold for drug development. The compound's specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, 3-(2,5-Dimethyl-3-thienyl)pyrrolidine represents a versatile structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H15NS
InChI:InChI=1S/C10H15NS/c1-7-5-10(8(2)12-7)9-3-4-11-6-9/h5,9,11H,3-4,6H2,1-2H3
InChI key:InChIKey=GLCSILGTYJKWLE-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C)S1)C2CCNC2
Synonyms:
  • 3-(2,5-Dimethyl-3-thienyl)pyrrolidine
  • Pyrrolidine, 3-(2,5-dimethyl-3-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.