
CAS 1260654-34-9
:1-(3-Chloro-2-fluorophenyl)cyclopentanecarbonitrile
Description:
1-(3-Chloro-2-fluorophenyl)cyclopentanecarbonitrile is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a cyano group attached to a phenyl ring that is substituted with both chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the presence of halogen substituents. The cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and substitutions. The presence of the chlorine and fluorine atoms can influence the compound's electronic properties, potentially enhancing its biological activity or altering its solubility in different solvents. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Overall, its unique structural features and functional groups suggest a range of potential applications in pharmaceuticals and materials science.
Formula:C12H11ClFN
InChI:InChI=1S/C12H11ClFN/c13-10-5-3-4-9(11(10)14)12(8-15)6-1-2-7-12/h3-5H,1-2,6-7H2
InChI key:InChIKey=JQUUHXWFKFTJOO-UHFFFAOYSA-N
SMILES:C(#N)C1(CCCC1)C2=C(F)C(Cl)=CC=C2
Synonyms:- 1-(3-Chloro-2-fluorophenyl)cyclopentanecarbonitrile
- Cyclopentanecarbonitrile, 1-(3-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.