CAS 1260654-38-3

2-Amino-6-chloro-4-pyridinecarboxaldehyde

Description:

2-Amino-6-chloro-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a chloro group (-Cl) at specific positions on the pyridine ring, along with an aldehyde functional group (-CHO) attached to the carboxylic carbon. The presence of these functional groups contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The compound is likely to exhibit polar characteristics due to the electronegative chlorine and nitrogen atoms, influencing its solubility in polar solvents. Additionally, the amino group may participate in hydrogen bonding, enhancing its interactions with other molecules. This compound may be of interest in medicinal chemistry and material science, particularly in the synthesis of biologically active compounds or as intermediates in organic synthesis. Safety and handling precautions should be observed due to the presence of chlorine and the potential reactivity of the aldehyde group.

Formula: C₆H₅ClN₂O

InChI: InChI=1S/C6H5ClN2O/c7-5-1-4(3-10)2-6(8)9-5/h1-3H,(H2,8,9)

InChI key: InChIKey=OGMMCXGPZAZYHU-UHFFFAOYSA-N

SMILES: C(=O)C=1C=C(Cl)N=C(N)C1

Synonyms:

• 2-Amino-6-chloro-4-pyridinecarboxaldehyde
• 4-Pyridinecarboxaldehyde, 2-amino-6-chloro-