CymitQuimica logo

CAS 1260655-14-8

:

5-Hydrazinyl-6,7-dihydro-5H-cyclopenta[b]pyridine

Description:
5-Hydrazinyl-6,7-dihydro-5H-cyclopenta[b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a hydrazine functional group. This compound features a cyclopenta[b]pyridine framework, indicating the presence of both a cyclopentane and a pyridine ring, contributing to its potential biological activity and chemical reactivity. The hydrazinyl group (-NH-NH2) is known for its ability to participate in various chemical reactions, including those involving oxidation and coupling reactions, making this compound of interest in medicinal chemistry and drug development. Its structural features may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in different environments. Overall, 5-Hydrazinyl-6,7-dihydro-5H-cyclopenta[b]pyridine represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation in the context of therapeutic applications.
Formula:C8H11N3
InChI:InChI=1S/C8H11N3/c9-11-8-4-3-7-6(8)2-1-5-10-7/h1-2,5,8,11H,3-4,9H2
InChI key:InChIKey=HZISADDEVGZIDC-UHFFFAOYSA-N
SMILES:N(N)C1C=2C(CC1)=NC=CC2
Synonyms:
  • 5H-Cyclopenta[b]pyridine, 5-hydrazinyl-6,7-dihydro-
  • 5-Hydrazinyl-6,7-dihydro-5H-cyclopenta[b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.