
CAS 1260656-95-8
:[2-(3,5-Dimethoxyphenyl)ethyl]hydrazine
Description:
[2-(3,5-Dimethoxyphenyl)ethyl]hydrazine is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the 3,5-dimethoxyphenyl group suggests that this compound may exhibit interesting electronic properties due to the electron-donating methoxy substituents, which can influence its reactivity and interaction with biological targets. Typically, compounds of this nature may be investigated for their potential as pharmaceuticals, particularly in the context of neurochemistry or as intermediates in the synthesis of more complex molecules. The hydrazine moiety is often associated with biological activity, including potential antitumor and antimicrobial properties. However, due to the inherent toxicity of hydrazines, safety precautions are essential when handling such compounds. Overall, [2-(3,5-Dimethoxyphenyl)ethyl]hydrazine represents a class of compounds that may hold promise in various chemical and pharmaceutical applications, warranting further research into its properties and potential uses.
Formula:C10H16N2O2
InChI:InChI=1S/C10H16N2O2/c1-13-9-5-8(3-4-12-11)6-10(7-9)14-2/h5-7,12H,3-4,11H2,1-2H3
InChI key:InChIKey=QDPFWZLWEBRNTA-UHFFFAOYSA-N
SMILES:C(CNN)C1=CC(OC)=CC(OC)=C1
Synonyms:- [2-(3,5-Dimethoxyphenyl)ethyl]hydrazine
- Hydrazine, [2-(3,5-dimethoxyphenyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.