CAS 1260658-80-7

1-(1-Methylethyl)-1H-pyrazole-5-acetic acid

Description:

1-(1-Methylethyl)-1H-pyrazole-5-acetic acid, identified by its CAS number 1260658-80-7, is a chemical compound that belongs to the class of pyrazole derivatives. This substance features a pyrazole ring, which is a five-membered aromatic ring containing two nitrogen atoms, and is substituted with an isopropyl group and an acetic acid moiety. The presence of the acetic acid functional group suggests that it may exhibit acidic properties, potentially allowing it to participate in various chemical reactions, including esterification and amidation. The compound's structure may confer specific biological activities, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 1-(1-Methylethyl)-1H-pyrazole-5-acetic acid represents a unique molecular structure with potential applications in medicinal chemistry and related fields.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c1-6(2)10-7(3-4-9-10)5-8(11)12/h3-4,6H,5H2,1-2H3,(H,11,12)

InChI key: InChIKey=KERNJHQTKQDPJH-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N(C(C)C)N=CC1

Synonyms:

• 1-(1-Methylethyl)-1H-pyrazole-5-acetic acid
• 1H-Pyrazole-5-acetic acid, 1-(1-methylethyl)-