CAS 1260658-87-4

1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-acetic acid

Description:

1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-acetic acid, identified by its CAS number 1260658-87-4, is a chemical compound that belongs to the class of pyrazole derivatives. This substance features a pyrazole ring, which is a five-membered aromatic ring containing two nitrogen atoms, and is substituted with a methyl group and an isopropyl group, contributing to its unique structure and properties. The presence of the acetic acid functional group indicates that it has acidic characteristics, which may influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, and its derivatives could be explored for various applications, including anti-inflammatory or analgesic properties. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications in research or industry.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-6(2)8-4-7(5-9(12)13)11(3)10-8/h4,6H,5H2,1-3H3,(H,12,13)

InChI key: InChIKey=APIWRXFOTQSZPG-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=CC(C(C)C)=NN1C

Synonyms:

• 1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-acetic acid
• 1H-Pyrazole-5-acetic acid, 1-methyl-3-(1-methylethyl)-