CAS 1260658-90-9

5-(Chloromethyl)-1-(1-methylethyl)-1H-pyrazole

Description:

5-(Chloromethyl)-1-(1-methylethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a chloromethyl group at the 5-position and an isopropyl group at the 1-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. The chloromethyl group can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the isopropyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. As with many pyrazole derivatives, it may exhibit biological activity, making it of interest in pharmaceutical research. Proper handling and safety precautions should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₇H₁₁ClN₂

InChI: InChI=1S/C7H11ClN2/c1-6(2)10-7(5-8)3-4-9-10/h3-4,6H,5H2,1-2H3

InChI key: InChIKey=QEDPJNDEFANEPJ-UHFFFAOYSA-N

SMILES: C(Cl)C=1N(C(C)C)N=CC1

Synonyms:

• 5-(Chloromethyl)-1-(1-methylethyl)-1H-pyrazole
• 1H-Pyrazole, 5-(chloromethyl)-1-(1-methylethyl)-

5-(Chloromethyl)-1-(propan-2-yl)-1H-pyrazole

CAS: 1260658-90-9

Versatile small molecule scaffold

Formula: C₇H₁₁ClN₂

Purity: Min. 95%

Molecular weight: 158.63 g/mol

Ref: 3D-KAC65890