CAS 1260658-97-6

1-(1-Methylethyl)-1H-pyrazole-3-acetic acid

Description:

1-(1-Methylethyl)-1H-pyrazole-3-acetic acid, identified by its CAS number 1260658-97-6, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an isopropyl group (1-methylethyl) attached to the pyrazole, contributing to its hydrophobic properties. The presence of the acetic acid functional group indicates that it possesses acidic characteristics, allowing it to participate in various chemical reactions, including esterification and neutralization. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents, due to the biological activity often associated with pyrazole derivatives. Additionally, the compound's solubility and stability in different solvents can vary, influencing its usability in various formulations. Overall, 1-(1-Methylethyl)-1H-pyrazole-3-acetic acid represents a versatile compound with potential applications in medicinal chemistry and agrochemicals.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c1-6(2)10-4-3-7(9-10)5-8(11)12/h3-4,6H,5H2,1-2H3,(H,11,12)

InChI key: InChIKey=ZFOZATJOXAYSNN-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=NN(C(C)C)C=C1

Synonyms:

• 1H-Pyrazole-3-acetic acid, 1-(1-methylethyl)-
• 1-(1-Methylethyl)-1H-pyrazole-3-acetic acid
• (1-Isopropyl-1H-pyrazol-3-yl)acetic acid
• 2-(1-Isopropyl-1H-pyrazol-3-yl)acetic acid
• 2-[1-(Propan-2-yl)-1H-pyrazol-3-yl]acetic acid

2-[1-(Propan-2-yl)-1H-pyrazol-3-yl]acetic acid

CAS: 1260658-97-6

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 168.19 g/mol

Ref: 3D-KAC65897