CAS 1260659-00-4: 1-Cyclopentyl-1H-pyrazole-3-acetonitrile

Description: 1-Cyclopentyl-1H-pyrazole-3-acetonitrile is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and a pyrazole ring. This compound features a cyano group (-C≡N) attached to the pyrazole, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the cyclopentyl moiety may influence its lipophilicity and biological activity. Typically, compounds like this can exhibit interesting pharmacological properties, making them candidates for further research in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could lead to the development of new therapeutic agents. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it essential to consider these factors in practical applications. Overall, 1-Cyclopentyl-1H-pyrazole-3-acetonitrile represents a class of compounds that may hold significance in drug discovery and development.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c11-7-5-9-6-8-13(12-9)10-3-1-2-4-10/h6,8,10H,1-5H2

InChI key: InChIKey=XJKVJURGXVDKRG-UHFFFAOYSA-N

SMILES: N#CCC1=NN(C=C1)C2CCCC2

Synonyms:

• 1-Cyclopentyl-1H-pyrazole-3-acetonitrile
• 1H-Pyrazole-3-acetonitrile, 1-cyclopentyl-

2-(1-Cyclopentyl-1H-pyrazol-3-yl)acetonitrile

CAS: 1260659-00-4

Versatile small molecule scaffold

• Formula: C₁₀H₁₃N₃
• Purity: Min. 95%
• Molecular weight: 175.23 g/mol

(1-cyclopentyl-1H-pyrazol-3-yl)acetonitrile

CAS: 1260659-00-4

• Molecular weight: 175.23500061035156