
CAS 1260659-11-7
:1-Ethyl-3-methyl-1H-pyrazole-5-acetic acid
Description:
1-Ethyl-3-methyl-1H-pyrazole-5-acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and a methyl group attached to the pyrazole ring, contributing to its unique properties. The presence of the acetic acid functional group enhances its solubility in polar solvents and may influence its reactivity and biological activity. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the environment in which it is studied. Overall, 1-Ethyl-3-methyl-1H-pyrazole-5-acetic acid represents a class of compounds that can be valuable in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c1-3-10-7(5-8(11)12)4-6(2)9-10/h4H,3,5H2,1-2H3,(H,11,12)
InChI key:InChIKey=ZAFMGHCAPLNLDT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N(CC)N=C(C)C1
Synonyms:- 1-Ethyl-3-methyl-1H-pyrazole-5-acetic acid
- 1H-Pyrazole-5-acetic acid, 1-ethyl-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.