CAS 1260659-19-5

3-(Chloromethyl)-1-cyclopentyl-1H-pyrazole

Description:

3-(Chloromethyl)-1-cyclopentyl-1H-pyrazole is a chemical compound characterized by its unique pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a chloromethyl group (-CH2Cl) enhances its reactivity, making it a potential intermediate in organic synthesis. The cyclopentyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, as pyrazole derivatives are often investigated for their potential as anti-inflammatory, analgesic, or antitumor agents. The specific arrangement of substituents on the pyrazole ring can significantly affect its biological activity and chemical reactivity. Additionally, the compound's stability, boiling point, and melting point can vary based on environmental conditions and the presence of other functional groups. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 3-(Chloromethyl)-1-cyclopentyl-1H-pyrazole represents a versatile structure in medicinal chemistry and organic synthesis.

Formula: C₉H₁₃ClN₂

InChI: InChI=1S/C9H13ClN2/c10-7-8-5-6-12(11-8)9-3-1-2-4-9/h5-6,9H,1-4,7H2

InChI key: InChIKey=AVXQYBVQSTYEEM-UHFFFAOYSA-N

SMILES: C(Cl)C1=NN(C=C1)C2CCCC2

Synonyms:

• 1H-Pyrazole, 3-(chloromethyl)-1-cyclopentyl-
• 3-(Chloromethyl)-1-cyclopentyl-1H-pyrazole

3-(Chloromethyl)-1-cyclopentyl-1H-pyrazole

CAS: 1260659-19-5

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂

Purity: Min. 95%

Molecular weight: 184.66 g/mol

Ref: 3D-KAC65919