
CAS 1260659-20-8
:1-(Difluoromethyl)-1H-pyrazole-5-acetonitrile
Description:
1-(Difluoromethyl)-1H-pyrazole-5-acetonitrile is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a difluoromethyl group and an acetonitrile moiety. This compound typically exhibits properties associated with both heterocyclic compounds and nitriles, such as moderate polarity and potential reactivity due to the presence of the cyano group. The difluoromethyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. As a pyrazole derivative, it may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. The presence of fluorine atoms often contributes to increased metabolic stability and bioactivity. Additionally, the compound's synthesis and reactivity can be influenced by the presence of functional groups, making it a candidate for various chemical transformations. Overall, 1-(Difluoromethyl)-1H-pyrazole-5-acetonitrile represents a versatile structure with potential applications in pharmaceuticals and agrochemicals.
Formula:C6H5F2N3
InChI:InChI=1S/C6H5F2N3/c7-6(8)11-5(1-3-9)2-4-10-11/h2,4,6H,1H2
InChI key:InChIKey=OXFGRWAORDHNQB-UHFFFAOYSA-N
SMILES:C(F)(F)N1C(CC#N)=CC=N1
Synonyms:- 1-(Difluoromethyl)-1H-pyrazole-5-acetonitrile
- 1H-Pyrazole-5-acetonitrile, 1-(difluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.