CAS 1260659-21-9: 3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid

Description: 3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid is a chemical compound characterized by its unique pyrazole ring structure, which contributes to its potential biological activity. The presence of a cyclopropyl group enhances its structural complexity and may influence its interaction with biological targets. This compound features an acetic acid functional group, which can impart acidic properties and facilitate solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyrazole moiety's known involvement in various biological processes. The compound's CAS number, 1260659-21-9, allows for precise identification and retrieval of information in chemical databases. As with many pyrazole derivatives, it may exhibit diverse pharmacological activities, making it a subject of interest in drug discovery and development. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies and characterization.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-11-7(5-9(12)13)4-8(10-11)6-2-3-6/h4,6H,2-3,5H2,1H3,(H,12,13)

InChI key: InChIKey=UYPLEXRAASOZFR-UHFFFAOYSA-N

SMILES: O=C(O)CC1=CC(=NN1C)C2CC2

Synonyms:

• 3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid
• 1H-Pyrazole-5-acetic acid, 3-cyclopropyl-1-methyl-

2-(3-Cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid

CAS: 1260659-21-9

Versatile small molecule scaffold

• Formula: C₉H₁₂N₂O₂
• Purity: Min. 95%
• Molecular weight: 180.2 g/mol

(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid

CAS: 1260659-21-9

• Molecular weight: 180.20700073242188