CAS 1260659-21-9: 3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid
Description:3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid is a chemical compound characterized by its unique pyrazole ring structure, which contributes to its potential biological activity. The presence of a cyclopropyl group enhances its structural complexity and may influence its interaction with biological targets. This compound features an acetic acid functional group, which can impart acidic properties and facilitate solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyrazole moiety's known involvement in various biological processes. The compound's CAS number, 1260659-21-9, allows for precise identification and retrieval of information in chemical databases. As with many pyrazole derivatives, it may exhibit diverse pharmacological activities, making it a subject of interest in drug discovery and development. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies and characterization.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-11-7(5-9(12)13)4-8(10-11)6-2-3-6/h4,6H,2-3,5H2,1H3,(H,12,13)
InChI key:InChIKey=UYPLEXRAASOZFR-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC(=NN1C)C2CC2
- Synonyms:
- 3-Cyclopropyl-1-methyl-1H-pyrazole-5-acetic acid
- 1H-Pyrazole-5-acetic acid, 3-cyclopropyl-1-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(3-Cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid REF: 3D-KAC65921CAS: 1260659-21-9 | Min. 95% | 199.00 €~1,774.00 € | Wed 07 May 25 |
![]() | (3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid REF: 10-F428865CAS: 1260659-21-9 | - - - | - - - | Discontinued product |

2-(3-Cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid
Ref: 3D-KAC65921
50mg | 522.00 € | ||
500mg | 1,422.00 € |

(3-cyclopropyl-1-methyl-1H-pyrazol-5-yl)acetic acid
Ref: 10-F428865
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
250mg | Discontinued | Request information |