CAS 1260659-30-0

5-(Chloromethyl)-1-(difluoromethyl)-1H-pyrazole

Description:

5-(Chloromethyl)-1-(difluoromethyl)-1H-pyrazole is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloromethyl group and a difluoromethyl group contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chloromethyl group can serve as a reactive site for further chemical modifications, while the difluoromethyl group may enhance the compound's lipophilicity and biological activity. This compound is typically synthesized through specific organic reactions that introduce the chloromethyl and difluoromethyl substituents onto the pyrazole framework. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of fluorine atoms often imparts desirable properties such as increased metabolic stability and improved binding affinity in biological systems. As with many pyrazole derivatives, the compound may exhibit interesting pharmacological activities, warranting further investigation into its biological effects and mechanisms of action.

Formula: C₅H₅ClF₂N₂

InChI: InChI=1S/C5H5ClF2N2/c6-3-4-1-2-9-10(4)5(7)8/h1-2,5H,3H2

InChI key: InChIKey=UWYWXGIJGWBRLN-UHFFFAOYSA-N

SMILES: C(Cl)C=1N(C(F)F)N=CC1

Synonyms:

• 5-(Chloromethyl)-1-(difluoromethyl)-1H-pyrazole
• 1H-Pyrazole, 5-(chloromethyl)-1-(difluoromethyl)-