CAS 1260659-32-2

1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile

Description:

1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an ethyl group and a trifluoromethyl group, as well as an acetonitrile functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits notable properties such as high stability under standard conditions and potential reactivity due to the presence of the nitrile and trifluoromethyl groups, which can influence its chemical behavior and interactions. The trifluoromethyl group imparts significant lipophilicity and can enhance biological activity, making this compound of interest in various fields, including pharmaceuticals and agrochemicals. Its synthesis often involves multi-step organic reactions, and it may be utilized in research related to drug development or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₈F₃N₃

InChI: InChI=1S/C8H8F3N3/c1-2-14-6(3-4-12)5-7(13-14)8(9,10)11/h5H,2-3H2,1H3

InChI key: InChIKey=JCSLDLDVHAWASM-UHFFFAOYSA-N

SMILES: C(C#N)C=1N(CC)N=C(C(F)(F)F)C1

Synonyms:

• 1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile
• 1H-Pyrazole-5-acetonitrile, 1-ethyl-3-(trifluoromethyl)-
• 2-(1-ethyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)acetonitrile
• [1-ethyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]acetonitrile