CymitQuimica logo

CAS 1260659-38-8

:

Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate

Description:
Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group at the 4-position and a methyl group at the 1-position of the pyrazole ring enhances its potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylate moiety at the 5-position is indicative of its acidic properties, which can influence its behavior in biological systems and chemical syntheses. This compound is of interest in medicinal chemistry and agricultural applications, often explored for its potential as a building block in drug development or as a herbicide. Its molecular properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate is a versatile compound with significant implications in various fields of research.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c1-3-12-7(11)6-5(8)4-9-10(6)2/h4H,3,8H2,1-2H3
InChI key:InChIKey=DWMHSYJNGCJAQY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)C=NN1C
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 4-amino-1-methyl-, ethyl ester
  • 4-Amino-2-methyl-2H-pyrazole-3-carboxylic acid ethyl ester
  • Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.