CymitQuimica logo

CAS 1260663-11-3

:

5-(Trifluoromethyl)-2-thiophenecarboximidamide

Description:
5-(Trifluoromethyl)-2-thiophenecarboximidamide is a chemical compound characterized by its unique structural features, including a thiophene ring and a trifluoromethyl group. The presence of the trifluoromethyl group contributes to its distinct electronic properties, enhancing its reactivity and potential applications in various chemical reactions. The carboximidamide functional group indicates that the compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with other molecules. This compound may be of interest in pharmaceutical chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. Additionally, the thiophene moiety can impart aromatic characteristics, which may affect the compound's stability and reactivity. Overall, 5-(Trifluoromethyl)-2-thiophenecarboximidamide represents a versatile structure with potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C6H5F3N2S
InChI:InChI=1S/C6H5F3N2S/c7-6(8,9)4-2-1-3(12-4)5(10)11/h1-2H,(H3,10,11)
InChI key:InChIKey=XKVMMOZZCWGHSX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1SC(C(=N)N)=CC1
Synonyms:
  • 2-Thiophenecarboximidamide, 5-(trifluoromethyl)-
  • 5-(Trifluoromethyl)-2-thiophenecarboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.