CAS 1260663-14-6

3-Acetyl-5-chloro-2(1H)-pyridinone

Description:

3-Acetyl-5-chloro-2(1H)-pyridinone is a chemical compound characterized by its pyridinone structure, which includes a pyridine ring substituted with an acetyl group and a chlorine atom. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, contributing to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions. Additionally, the acetyl group can participate in nucleophilic attacks, further expanding its utility in synthetic chemistry. The compound may also display biological activity, as many pyridinone derivatives are known for their pharmacological properties. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its handling and application in laboratory settings. Overall, 3-Acetyl-5-chloro-2(1H)-pyridinone is a versatile compound with significant implications in both research and industrial chemistry.

Formula: C₇H₆ClNO₂

InChI: InChI=1S/C7H6ClNO2/c1-4(10)6-2-5(8)3-9-7(6)11/h2-3H,1H3,(H,9,11)

InChI key: InChIKey=DKYPZJQKRJUNRI-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C(=O)NC=C(Cl)C1

Synonyms:

• 3-Acetyl-5-chloro-2(1H)-pyridinone
• 2(1H)-Pyridinone, 3-acetyl-5-chloro-