
CAS 1260663-31-7
:5,6,7,8-Tetrahydro-1,7-naphthyridin-4-ol
Description:
5,6,7,8-Tetrahydro-1,7-naphthyridin-4-ol is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a saturated ring system, contributing to its stability and potential biological activity. The presence of a hydroxyl group (-OH) at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological pathways. Additionally, the compound's unique arrangement of nitrogen and carbon atoms may confer specific pharmacological properties, making it a subject of interest in drug discovery. Its CAS number, 1260663-31-7, allows for precise identification and facilitates research and regulatory processes. Overall, 5,6,7,8-Tetrahydro-1,7-naphthyridin-4-ol represents a class of compounds that may exhibit diverse chemical behavior and biological significance.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c11-8-2-4-10-7-5-9-3-1-6(7)8/h2,4,9H,1,3,5H2,(H,10,11)
InChI key:InChIKey=DWEVIMCGOGPEOE-UHFFFAOYSA-N
SMILES:OC1=C2C(=NC=C1)CNCC2
Synonyms:- 1,7-Naphthyridin-4-ol, 5,6,7,8-tetrahydro-
- 5,6,7,8-Tetrahydro-1,7-naphthyridin-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.