CAS 1260663-56-6

4-Chloro-5-fluoro-2-pyridinecarbonitrile

Description:

4-Chloro-5-fluoro-2-pyridinecarbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of both chlorine and fluorine substituents on the pyridine ring contributes to its unique chemical properties, including increased reactivity and potential for forming hydrogen bonds. The cyano group (-C≡N) attached to the carbon atom adjacent to the nitrogen in the pyridine structure enhances its polarity and solubility in polar solvents. This compound is typically used in pharmaceutical research and development due to its potential as an intermediate in the synthesis of biologically active molecules. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens can influence the compound's electronic properties, making it a subject of interest in materials science and agrochemical applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₆H₂ClFN₂

InChI: InChI=1S/C6H2ClFN2/c7-5-1-4(2-9)10-3-6(5)8/h1,3H

InChI key: InChIKey=BBKXFSJFVSCOKU-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(Cl)=C(F)C=N1

Synonyms:

• 4-Chloro-5-fluoro-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 4-chloro-5-fluoro-