CAS 1260663-59-9

4,5-Difluoro-2-pyridinecarboxylic acid

Description:

4,5-Difluoro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two fluorine atoms and a carboxylic acid group. The fluorine substituents are located at the 4 and 5 positions of the pyridine ring, which can influence the compound's reactivity and polarity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. Its molecular structure allows for potential applications in pharmaceuticals and agrochemicals, as the fluorine atoms can enhance biological activity and metabolic stability. The compound's acidity is attributed to the carboxylic acid group, which can participate in hydrogen bonding and affect its interaction with other molecules. Additionally, the presence of fluorine can impart unique electronic properties, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₃F₂NO₂

InChI: InChI=1S/C6H3F2NO2/c7-3-1-5(6(10)11)9-2-4(3)8/h1-2H,(H,10,11)

InChI key: InChIKey=MXRNEBPXDNPBHM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(F)=C(F)C=N1

Synonyms:

• 4,5-Difluoro-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 4,5-difluoro-