
CAS 1260663-78-2
:5-Amino-2-fluoro-3-pyridinecarbonitrile
Description:
5-Amino-2-fluoro-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) and a cyano group (-C≡N) on the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. The fluorine atom at the 2-position of the pyridine enhances the compound's electronic properties, potentially influencing its biological activity and solubility. This compound may exhibit polar characteristics due to the presence of both the amino and cyano groups, which can engage in hydrogen bonding and dipole interactions. Its unique structure makes it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's properties may be further explored in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many nitrogen-containing heterocycles, it may also exhibit interesting pharmacological properties, warranting further investigation.
Formula:C6H4FN3
InChI:InChI=1S/C6H4FN3/c7-6-4(2-8)1-5(9)3-10-6/h1,3H,9H2
InChI key:InChIKey=OTAIRWWEIAXESD-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)N=CC(N)=C1
Synonyms:- 5-Amino-2-fluoro-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-amino-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.