CAS 1260664-03-6

3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-carboxylic acid

Description:

3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its fused pyridine and pyran rings. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the dihydropyran moiety indicates that it has a saturated structure, which can influence its chemical behavior and stability. The compound is likely to exhibit polar characteristics due to the carboxylic acid group, making it soluble in polar solvents. Its unique structure may also confer biological activity, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 1260664-03-6, allows for precise identification and retrieval of information in chemical databases. Overall, 3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-carboxylic acid is a complex molecule with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₉H₉NO₃

InChI: InChI=1S/C9H9NO3/c11-9(12)7-4-6-2-1-3-13-8(6)10-5-7/h4-5H,1-3H2,(H,11,12)

InChI key: InChIKey=AECRHVMMLYHHTH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=NC1)OCCC2

Synonyms:

• 2H,3H,4H-Pyrano[2,3-b]pyridine-6-carboxylic acid
• 2H-Pyrano[2,3-b]pyridine-6-carboxylic acid, 3,4-dihydro-
• 3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-carboxylic acid

3,4-Dihydro-2H-pyrano[2,3-b]-pyridine-6-carboxylic acid

CAS: 1260664-03-6

Versatile small molecule scaffold

Formula: C₉H₉NO₃

Purity: Min. 95%

Molecular weight: 179.18 g/mol

Ref: 3D-KAC66403