CAS 1260664-04-7

1-(3,5-Dichlorophenyl)cyclobutanamine

Description:

1-(3,5-Dichlorophenyl)cyclobutanamine is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a dichlorophenyl group. The presence of the dichlorophenyl moiety suggests that the compound may exhibit significant biological activity, potentially influencing its interaction with various biological targets. The cyclobutane ring contributes to the compound's rigidity and may affect its conformational properties, which can be crucial for its reactivity and pharmacological profile. The dichlorination at the 3 and 5 positions of the phenyl ring enhances the compound's lipophilicity and may influence its solubility and permeability in biological systems. Additionally, the amine functional group indicates potential for hydrogen bonding and reactivity, making it a candidate for further chemical modifications or as a lead compound in drug discovery. Overall, the combination of these structural features suggests that 1-(3,5-Dichlorophenyl)cyclobutanamine could have interesting applications in medicinal chemistry, although specific biological activities would require empirical investigation.

Formula: C₁₀H₁₁Cl₂N

InChI: InChI=1S/C10H11Cl2N/c11-8-4-7(5-9(12)6-8)10(13)2-1-3-10/h4-6H,1-3,13H2

InChI key: InChIKey=VXLZRGSPZUQQRQ-UHFFFAOYSA-N

SMILES: NC1(CCC1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• Cyclobutanamine, 1-(3,5-dichlorophenyl)-
• 1-(3,5-Dichlorophenyl)cyclobutanamine