CAS 1260664-17-2

2-Pyridinecarboxylic acid, 4-chloro-5-formyl-, methyl ester

Description:

2-Pyridinecarboxylic acid, 4-chloro-5-formyl-, methyl ester, also known by its CAS number 1260664-17-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, a formyl group, and a methyl ester, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent at the 4-position of the pyridine ring enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and stability in different solvents can vary, influencing its use in various applications, including pharmaceuticals and agrochemicals. Overall, this compound's unique structure and functional groups provide a foundation for diverse chemical reactivity and potential applications in research and industry.

Formula: C₈H₆ClNO₃

InChI: InChI=1S/C8H6ClNO3/c1-13-8(12)7-2-6(9)5(4-11)3-10-7/h2-4H,1H3

InChI key: InChIKey=ZAAVDYASXBGJIJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(Cl)=C(C=O)C=N1

Synonyms:

• Methyl 4-chloro-5-formylpyridine-2-carboxylate
• 2-Pyridinecarboxylic acid, 4-chloro-5-formyl-, methyl ester