CAS 1260664-52-5

4-Chloro-5,6,7,8-tetrahydro-1,7-naphthyridine

Description:

4-Chloro-5,6,7,8-tetrahydro-1,7-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a chlorine substituent at the 4-position and a saturated tetrahydro framework, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may possess biological activity, which can be explored in medicinal chemistry contexts. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many heterocycles, the electronic properties and steric factors associated with its structure can significantly affect its interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₉ClN₂

InChI: InChI=1S/C8H9ClN2/c9-7-2-4-11-8-5-10-3-1-6(7)8/h2,4,10H,1,3,5H2

InChI key: InChIKey=KJQOPYSRMZFLBH-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1)CNCC2

Synonyms:

• 4-Chloro-5,6,7,8-tetrahydro-1,7-naphthyridine
• 1,7-Naphthyridine, 4-chloro-5,6,7,8-tetrahydro-