
CAS 1260664-95-6
:1-(2-Fluoro-6-methoxy-3-pyridinyl)ethanone
Description:
1-(2-Fluoro-6-methoxy-3-pyridinyl)ethanone, identified by its CAS number 1260664-95-6, is a chemical compound characterized by its pyridine ring, which is substituted with a fluorine atom and a methoxy group. This compound features an ethanone functional group, indicating the presence of a carbonyl (C=O) adjacent to an ethyl group. The fluorine substitution typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group contributes to the compound's overall electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. The presence of these functional groups suggests that this compound may exhibit unique pharmacological properties, making it a candidate for further research in drug development. Additionally, its structural characteristics may allow for various synthetic modifications, which could lead to the discovery of new derivatives with enhanced efficacy or selectivity in therapeutic applications.
Formula:C8H8FNO2
InChI:InChI=1S/C8H8FNO2/c1-5(11)6-3-4-7(12-2)10-8(6)9/h3-4H,1-2H3
InChI key:InChIKey=XPAVDKLDFKIKIP-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(F)N=C(OC)C=C1
Synonyms:- 1-(2-Fluoro-6-methoxy-3-pyridinyl)ethanone
- Ethanone, 1-(2-fluoro-6-methoxy-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.