
CAS 1260665-10-8
:Carbamic acid, N-(5-bromo-4-chloro-2-pyridinyl)-, 1,1-dimethylethyl ester
Description:
Carbamic acid, N-(5-bromo-4-chloro-2-pyridinyl)-, 1,1-dimethylethyl ester, identified by CAS number 1260665-10-8, is a chemical compound that belongs to the class of carbamates. This substance features a pyridine ring substituted with bromine and chlorine, contributing to its unique reactivity and potential biological activity. The presence of the 1,1-dimethylethyl ester group enhances its lipophilicity, which may influence its absorption and distribution in biological systems. Carbamic acids are known for their role in various applications, including as pesticides and pharmaceuticals, due to their ability to inhibit certain enzymes. The specific halogen substitutions in this compound may also impart distinct properties, such as increased potency or selectivity in biological interactions. As with many chemical substances, safety and handling precautions are essential, as carbamates can exhibit toxicity depending on their structure and concentration. Overall, this compound's characteristics suggest potential utility in agrochemical or medicinal chemistry contexts, warranting further investigation into its properties and applications.
Formula:C10H12BrClN2O2
InChI:InChI=1S/C10H12BrClN2O2/c1-10(2,3)16-9(15)14-8-4-7(12)6(11)5-13-8/h4-5H,1-3H3,(H,13,14,15)
InChI key:InChIKey=DCUGQFAITQNZGB-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=CC(Cl)=C(Br)C=N1
Synonyms:- Carbamic acid, N-(5-bromo-4-chloro-2-pyridinyl)-, 1,1-dimethylethyl ester
- (5-Bromo-4-chloro-pyridin-2-yl)-carbamic acid tert-butyl ester
- tert-Butyl N-(5-bromo-4-chloropyridin-2-yl)carbamate
- tert-Butyl 5-bromo-4-chloropyridin-2-ylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.