CAS 1260665-43-7

6-Bromo-2,4-dichloropyrido[3,2-d]pyrimidine

Description:

6-Bromo-2,4-dichloropyrido[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. This compound features bromine and chlorine substituents, which can significantly influence its reactivity and biological activity. The presence of halogens often enhances lipophilicity and can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its structural complexity allows for potential applications in pharmaceuticals, particularly in the development of targeted therapies. The compound's molecular framework may also exhibit interesting electronic properties, making it a candidate for studies in materials science. Additionally, the specific arrangement of the halogen atoms can lead to distinct stereochemical configurations, which may further influence its chemical behavior and interactions. Overall, 6-Bromo-2,4-dichloropyrido[3,2-d]pyrimidine is a compound of interest due to its unique structure and potential applications in various fields of research.

Formula: C₇H₂BrCl₂N₃

InChI: InChI=1S/C7H2BrCl2N3/c8-4-2-1-3-5(12-4)6(9)13-7(10)11-3/h1-2H

InChI key: InChIKey=SVRRPUDXEZTLGZ-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(Cl)N1)C=CC(Br)=N2

Synonyms:

• 6-Bromo-2,4-dichloropyrido[3,2-d]pyrimidine
• Pyrido[3,2-d]pyrimidine, 6-bromo-2,4-dichloro-