
CAS 1260665-50-6
:2-(Chloromethyl)-6-methoxypyrazine
Description:
2-(Chloromethyl)-6-methoxypyrazine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) and a methoxy group (-OCH3) attached to the pyrazine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the chloromethyl group makes it a potential electrophile, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The methoxy group can influence the compound's solubility and reactivity, often enhancing its lipophilicity. 2-(Chloromethyl)-6-methoxypyrazine may be used in the synthesis of other organic compounds and could have applications in the fragrance and flavor industry due to its characteristic odor. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact.
Formula:C6H7ClN2O
InChI:InChI=1S/C6H7ClN2O/c1-10-6-4-8-3-5(2-7)9-6/h3-4H,2H2,1H3
InChI key:InChIKey=CUOBMFQXBQHUFA-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(OC)=CN=C1
Synonyms:- 2-(Chloromethyl)-6-methoxypyrazine
- Pyrazine, 2-(chloromethyl)-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.