CAS 1260665-61-9

1,1-Dimethylethyl 3-(1H-pyrazol-1-yl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(1H-pyrazol-1-yl)-1-piperidinecarboxylate, identified by its CAS number 1260665-61-9, is a chemical compound characterized by its complex structure that includes a piperidine ring and a pyrazole moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, which may influence its solubility, stability, and reactivity. The presence of the dimethyl group contributes to steric hindrance, potentially affecting its interaction with biological targets. As a carboxylate ester, it may participate in various chemical reactions, including hydrolysis and esterification. The pyrazole ring often imparts biological activity, making this compound of interest in medicinal chemistry. Its specific applications and biological properties would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, this compound represents a unique combination of structural features that may lead to diverse chemical behavior and potential applications in drug development or other fields of chemistry.

Formula: C₁₃H₂₁N₃O₂

InChI: InChI=1S/C13H21N3O2/c1-13(2,3)18-12(17)15-8-4-6-11(10-15)16-9-5-7-14-16/h5,7,9,11H,4,6,8,10H2,1-3H3

InChI key: InChIKey=YWWZZIFTZXYBOZ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(CCC1)N2C=CC=N2

Synonyms:

• 1,1-Dimethylethyl 3-(1H-pyrazol-1-yl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(1H-pyrazol-1-yl)-, 1,1-dimethylethyl ester