
CAS 1260665-78-8
:5,6,7,8-Tetrahydro-4-methoxy-1,7-naphthyridine
Description:
5,6,7,8-Tetrahydro-4-methoxy-1,7-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine core. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the naphthyridine ring system, resulting in a saturated structure. The presence of a methoxy group (-OCH3) at the 4-position contributes to its chemical reactivity and solubility properties. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anti-inflammatory effects. Its molecular structure allows for various interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the compound's unique structural features may influence its physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, 5,6,7,8-Tetrahydro-4-methoxy-1,7-naphthyridine represents a class of compounds that can be explored for therapeutic applications in drug development.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-12-9-3-5-11-8-6-10-4-2-7(8)9/h3,5,10H,2,4,6H2,1H3
InChI key:InChIKey=GECVXDBNXVSBSD-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=NC=C1)CNCC2
Synonyms:- 5,6,7,8-Tetrahydro-4-methoxy-1,7-naphthyridine
- 1,7-Naphthyridine, 5,6,7,8-tetrahydro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.