CAS 1260666-04-3
:5-Amino-6-bromo-3-pyridinecarbonitrile
Description:
5-Amino-6-bromo-3-pyridinecarbonitrile is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a bromo substituent (-Br) on the pyridine ring, as well as a cyano group (-C≡N) attached to the carbon adjacent to the nitrogen in the ring. The presence of these functional groups contributes to its reactivity and potential applications in medicinal chemistry and material science. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the cyano group can serve as a versatile building block for further chemical transformations. The bromine atom can also be involved in substitution reactions, making this compound a valuable intermediate in the synthesis of more complex molecules. Its unique structure and functional groups suggest potential uses in pharmaceuticals, agrochemicals, and as a precursor in organic synthesis.
Formula:C6H4BrN3
InChI:InChI=1S/C6H4BrN3/c7-6-5(9)1-4(2-8)3-10-6/h1,3H,9H2
InChI key:InChIKey=JXIXNBFPQYLNOQ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(N)C(Br)=NC1
Synonyms:- 5-Amino-6-bromo-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-amino-6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.