
CAS 1260666-48-5
:2-Chloro-6-(1-methylethyl)-3-pyridinamine
Description:
2-Chloro-6-(1-methylethyl)-3-pyridinamine, with the CAS number 1260666-48-5, is a chemical compound that belongs to the class of pyridinamines. It features a pyridine ring substituted with a chlorine atom at the 2-position and an isopropyl group at the 6-position, along with an amino group at the 3-position. This structure contributes to its unique chemical properties, including potential reactivity due to the presence of the amino and chloro functional groups. The compound may exhibit polar characteristics due to the nitrogen atom in the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can influence biological activity. Additionally, the presence of the chlorine atom may enhance lipophilicity, affecting the compound's solubility and permeability. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c1-5(2)7-4-3-6(10)8(9)11-7/h3-5H,10H2,1-2H3
InChI key:InChIKey=PKZUQSSINWZWRF-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C(Cl)C(N)=CC1
Synonyms:- 3-Pyridinamine, 2-chloro-6-(1-methylethyl)-
- 2-Chloro-6-(1-methylethyl)-3-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.