CAS 1260666-53-2

4-Isocyanato-2-methylpyridine

Description:

4-Isocyanato-2-methylpyridine is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a pyridine ring, specifically at the 4-position, with a methyl group at the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity, particularly due to the isocyanate group, which can readily participate in nucleophilic addition reactions with amines, alcohols, and other nucleophiles. This reactivity makes it valuable in the synthesis of various polymers, pharmaceuticals, and agrochemicals. Additionally, 4-Isocyanato-2-methylpyridine may exhibit moderate toxicity and should be handled with care, as isocyanates are known to be respiratory irritants and potential sensitizers. Its molecular structure contributes to its unique chemical properties, making it a subject of interest in both industrial applications and research settings. Proper safety measures should be observed when working with this compound to mitigate any health risks.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c1-6-4-7(9-5-10)2-3-8-6/h2-4H,1H3

InChI key: InChIKey=IRODOIUOHUEHEY-UHFFFAOYSA-N

SMILES: N(=C=O)C=1C=C(C)N=CC1

Synonyms:

• 4-Isocyanato-2-methylpyridine
• Pyridine, 4-isocyanato-2-methyl-