CAS 1260667-43-3

5-Bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid

Description:

5-Bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a pyridine ring, and an amide functional group. The presence of the bromine substituent enhances its reactivity and potential applications in organic synthesis. The dimethylethoxycarbonyl group contributes to its stability and solubility in organic solvents, making it suitable for various chemical reactions. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its carboxylic acid functionality allows for further derivatization, enabling the formation of esters or amides. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, which can be explored for therapeutic applications. Overall, 5-Bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid is a versatile building block in medicinal chemistry, with potential implications in drug discovery and development.

Formula: C₁₁H₁₃BrN₂O₄

InChI: InChI=1S/C11H13BrN2O4/c1-11(2,3)18-10(17)14-8-4-6(9(15)16)7(12)5-13-8/h4-5H,1-3H3,(H,15,16)(H,13,14,17)

InChI key: InChIKey=QLMXDJJNFIQLTO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=CN=C(NC(OC(C)(C)C)=O)C1

Synonyms:

• 4-Pyridinecarboxylic acid, 5-bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-
• 5-Bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid