CAS 1260667-45-5

1-(2-Nitrophenyl)cyclobutanamine

Description:

1-(2-Nitrophenyl)cyclobutanamine is an organic compound characterized by its cyclobutane ring structure substituted with a 2-nitrophenyl group and an amine functional group. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity and solubility in various solvents. This compound is likely to exhibit properties typical of both aromatic and aliphatic amines, including potential basicity due to the amine group. The nitrophenyl moiety may also impart additional functionalities, such as the ability to participate in electrophilic aromatic substitution reactions. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the potential biological activity associated with both the amine and nitro functionalities. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from chemical databases for precise applications. Safety data should also be consulted, as nitro compounds can be hazardous.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c11-10(6-3-7-10)8-4-1-2-5-9(8)12(13)14/h1-2,4-5H,3,6-7,11H2

InChI key: InChIKey=KFONHEHUWOIMFC-UHFFFAOYSA-N

SMILES: NC1(CCC1)C2=C(N(=O)=O)C=CC=C2

Synonyms:

• 1-(2-Nitrophenyl)cyclobutanamine
• Cyclobutanamine, 1-(2-nitrophenyl)-