CAS 1260667-66-0

5-Bromo-6-methyl-2-pyrazinecarbonitrile

Description:

5-Bromo-6-methyl-2-pyrazinecarbonitrile is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a methyl group at the 6-position contributes to its unique chemical properties. The cyano group (-C≡N) at the 2-position enhances its reactivity, making it useful in various synthetic applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for potential interactions in biological systems, which can be explored for pharmaceutical applications. Additionally, the presence of halogen and cyano functionalities suggests that it may participate in nucleophilic substitution reactions and other transformations. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 5-Bromo-6-methyl-2-pyrazinecarbonitrile is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse reactivity and potential applications.

Formula: C₆H₄BrN₃

InChI: InChI=1S/C6H4BrN3/c1-4-6(7)9-3-5(2-8)10-4/h3H,1H3

InChI key: InChIKey=YHHIZWGAFSJSCL-UHFFFAOYSA-N

SMILES: C(#N)C1=NC(C)=C(Br)N=C1

Synonyms:

• 5-Bromo-6-methyl-2-pyrazinecarbonitrile
• 2-Pyrazinecarbonitrile, 5-bromo-6-methyl-